ChemNet > CAS > 365-12-8 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid
365-12-8 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid
Ürün Adı |
2'-fluoro[1,1'-biphenyl]-4-carboxylic acid |
ingilizce adı |
2'-fluoro[1,1'-biphenyl]-4-carboxylic acid; 2-Fluorobiphenyl-4-carboxylic acid; bis(4-fluorophenyl)methanol; 2'-fluorobiphenyl-4-carboxylate |
Moleküler Formülü |
C13H8FO2 |
Molekül Ağırlığı |
215.2004 |
InChI |
InChI=1/C13H9FO2/c14-12-4-2-1-3-11(12)9-5-7-10(8-6-9)13(15)16/h1-8H,(H,15,16)/p-1 |
CAS kayıt numarası |
365-12-8 |
EINECS |
206-671-8 |
Moleküler Yapısı |
|
Ergime noktası |
234℃ |
Kaynama noktası |
363.9°C at 760 mmHg |
Alevlenme noktası |
173.9°C |
Buhar basıncı |
6.2E-06mmHg at 25°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|